Products 1465873-61-3
CAS 1465873-61-3 is the registry number for 5-Bromo-7-chloro-2,3-dihydro-1-benzofuran-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-ol (CAS 1465873-61-3) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-ol. InChIKey: IZOMKZHYRTXLCP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | IZOMKZHYRTXLCP-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC(=C2)Br)Cl)O |
Computed by PubChem (NCBI)