CAS 146669-29-6 appears in our catalog under these names: (RS)-MCPG, (RS)–MCPG, (±)-α-Methyl-(4-carboxyphenyl)glycine, 98%, 98%, (RS)-MCPG, 99.05%, (RS)-MCPG (Standard). Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL.
4-(1-amino-1-carboxyethyl)benzoic acid (CAS 146669-29-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 4-(1-amino-1-carboxyethyl)benzoic acid. InChIKey: DNCAZYRLRMTVSF-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-(1-amino-1-carboxyethyl)benzoic acid |
| InChIKey | DNCAZYRLRMTVSF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)