Products 146801-29-8
CAS 146801-29-8 is the registry number for 5,5,5-Trifluoro-4-hydroxy-4-phenylpentan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one (CAS 146801-29-8) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one. InChIKey: VJAXMKZOQDXQPI-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one |
| InChIKey | VJAXMKZOQDXQPI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=CC=CC=C1)(C(F)(F)F)O |
Computed by PubChem (NCBI)