CAS 1469749-00-5 is the registry number for 5-Bromo-8-chloro-3,4-dihydroisoquinolin-1(2H)-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-8-chloro-3,4-dihydro-2H-isoquinolin-1-one (CAS 1469749-00-5) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: 5-bromo-8-chloro-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: RXDPHNQHIIYKBV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO |
|---|---|
| Molecular weight | 260.51 g/mol |
| IUPAC name | 5-bromo-8-chloro-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | RXDPHNQHIIYKBV-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(C=CC(=C21)Br)Cl |
Computed by PubChem (NCBI)