Products 951920-69-7
CAS 951920-69-7 appears in our catalog under these names: 2-(4-Bromo-2-chlorophenoxy)propanenitrile, 95%, 2-(4-Bromo-2-chlorophenoxy)propanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(4-bromo-2-chlorophenoxy)propanenitrile (CAS 951920-69-7) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenoxy)propanenitrile. InChIKey: GWKJRFPDTCDADM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO |
|---|---|
| Molecular weight | 260.51 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenoxy)propanenitrile |
| InChIKey | GWKJRFPDTCDADM-UHFFFAOYSA-N |
| SMILES | CC(C#N)OC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)