Products 2064122-42-3
CAS 2064122-42-3 is the registry number for 3-(2-BROMO-4-CHLOROPHENYL)-4,5-DIHYDROISOXAZOLE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(2-bromo-4-chlorophenyl)-4,5-dihydro-1,2-oxazole (CAS 2064122-42-3) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: 3-(2-bromo-4-chlorophenyl)-4,5-dihydro-1,2-oxazole. InChIKey: ULUONLUKMKCEHY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO |
|---|---|
| Molecular weight | 260.51 g/mol |
| IUPAC name | 3-(2-bromo-4-chlorophenyl)-4,5-dihydro-1,2-oxazole |
| InChIKey | ULUONLUKMKCEHY-UHFFFAOYSA-N |
| SMILES | C1CON=C1C2=C(C=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)