Products 1807700-27-1

CAS 1807700-27-1 is the registry number for 2-(3-Chloro-4-bromo-phenyl)-4,5-dihydro-oxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole (CAS 1807700-27-1) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole. InChIKey: WXBBNMKUUJAMBU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrClNO
Molecular weight260.51 g/mol
IUPAC name2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole
InChIKeyWXBBNMKUUJAMBU-UHFFFAOYSA-N
SMILESC1COC(=N1)C2=CC(=C(C=C2)Br)Cl

Computed by PubChem (NCBI)