CAS 1807700-27-1 is the registry number for 2-(3-Chloro-4-bromo-phenyl)-4,5-dihydro-oxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole (CAS 1807700-27-1) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole. InChIKey: WXBBNMKUUJAMBU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO |
|---|---|
| Molecular weight | 260.51 g/mol |
| IUPAC name | 2-(4-bromo-3-chlorophenyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | WXBBNMKUUJAMBU-UHFFFAOYSA-N |
| SMILES | C1COC(=N1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)