CAS 2741324-43-4 is the registry number for (4-Bromo-6-chloropyridin-3-yl)(cyclopropyl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-6-chloro-3-pyridinyl)-cyclopropylmethanone (CAS 2741324-43-4) is a chemical compound with the molecular formula C9H7BrClNO and a molecular weight of 260.51 g/mol. IUPAC name: (4-bromo-6-chloro-3-pyridinyl)-cyclopropylmethanone. InChIKey: QNDNZJMRFOZCHP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO |
|---|---|
| Molecular weight | 260.51 g/mol |
| IUPAC name | (4-bromo-6-chloro-3-pyridinyl)-cyclopropylmethanone |
| InChIKey | QNDNZJMRFOZCHP-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CN=C(C=C2Br)Cl |
Computed by PubChem (NCBI)