CAS 147003-46-1 appears in our catalog under these names: Methyl 2-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetate, 95%, Methyl-2-(2-amino-4-phenylthiazol-5-yl)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
Methyl 2-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetate (CAS 147003-46-1) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: methyl 2-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetate. InChIKey: UEALQOSQARFHSD-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | methyl 2-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetate |
| InChIKey | UEALQOSQARFHSD-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(N=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)