CAS 14702-34-2 appears in our catalog under these names: 3-Methyl-3-phenyloxolane-2,5-dione, 95%, 3-Methyl-3-phenyloxolane-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-methyl-3-phenyloxolane-2,5-dione (CAS 14702-34-2) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 3-methyl-3-phenyloxolane-2,5-dione. InChIKey: AEEWWNZSKBVUBZ-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-methyl-3-phenyloxolane-2,5-dione |
| InChIKey | AEEWWNZSKBVUBZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)