CAS 147127-97-7 is the registry number for (1S)-1,4(1,4)-Dibenzenacyclohexaphane-12-carbaldehyde 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde (CAS 147127-97-7) is a chemical compound with the molecular formula C17H16O and a molecular weight of 236.31 g/mol. IUPAC name: tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde. InChIKey: BAIBHOHKSYVVCM-UHFFFAOYSA-N.
| Molecular formula | C17H16O |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde |
| InChIKey | BAIBHOHKSYVVCM-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)C=O |
Computed by PubChem (NCBI)