CAS 94540-41-7 appears in our catalog under these names: Phenyl(1,2,3,4-tetrahydronaphthalen-1-yl)methanone, 95%, Phenyl(1,2,3,4-tetrahydronaphthalen-1-yl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Phenyl(1,2,3,4-tetrahydronaphthalen-1-yl)methanone (CAS 94540-41-7) is a chemical compound with the molecular formula C17H16O and a molecular weight of 236.31 g/mol. IUPAC name: phenyl(1,2,3,4-tetrahydronaphthalen-1-yl)methanone. InChIKey: PBOUTGGNTILOQZ-UHFFFAOYSA-N.
| Molecular formula | C17H16O |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | phenyl(1,2,3,4-tetrahydronaphthalen-1-yl)methanone |
| InChIKey | PBOUTGGNTILOQZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)