CAS 24295-83-8 is the registry number for 1,2,3,6,7,8-Hexahydropyrene-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,6,7,8-hexahydropyrene-4-carbaldehyde (CAS 24295-83-8) is a chemical compound with the molecular formula C17H16O and a molecular weight of 236.31 g/mol. IUPAC name: 1,2,3,6,7,8-hexahydropyrene-4-carbaldehyde. InChIKey: GTUTUKGDHCZIGR-UHFFFAOYSA-N.
| Molecular formula | C17H16O |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 1,2,3,6,7,8-hexahydropyrene-4-carbaldehyde |
| InChIKey | GTUTUKGDHCZIGR-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC(=C4C3=C(CCC4)C=C2)C=O)C1 |
Computed by PubChem (NCBI)