CAS 21551-47-3 is the registry number for 1,3-Di-p-tolylprop-2-en-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
(E)-1,3-bis(4-methylphenyl)prop-2-en-1-one (CAS 21551-47-3) is a chemical compound with the molecular formula C17H16O and a molecular weight of 236.31 g/mol. IUPAC name: (E)-1,3-bis(4-methylphenyl)prop-2-en-1-one. InChIKey: DTEBZGKINVACPT-FMIVXFBMSA-N.
| Molecular formula | C17H16O |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | (E)-1,3-bis(4-methylphenyl)prop-2-en-1-one |
| InChIKey | DTEBZGKINVACPT-FMIVXFBMSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)