CAS 72322-75-9 appears in our catalog under these names: 1-(9,9-Dimethyl-9h-fluoren-2-yl)ethanone, 95%, 2-Acetyl-9,9-dimethyl-fluorene, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 10g, 5g, 1g, 250mg, 25g.
1-(9,9-dimethylfluoren-2-yl)ethanone (CAS 72322-75-9) is a chemical compound with the molecular formula C17H16O and a molecular weight of 236.31 g/mol. IUPAC name: 1-(9,9-dimethylfluoren-2-yl)ethanone. InChIKey: OIJLIPUKPVAPCP-UHFFFAOYSA-N.
| Molecular formula | C17H16O |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 1-(9,9-dimethylfluoren-2-yl)ethanone |
| InChIKey | OIJLIPUKPVAPCP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3=CC=CC=C3C2(C)C |
Computed by PubChem (NCBI)