CAS 147425-79-4 is the registry number for 5-Acetylpyrazine-2-carboxamide 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-acetylpyrazine-2-carboxamide (CAS 147425-79-4) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: 5-acetylpyrazine-2-carboxamide. InChIKey: ALPVAENMJMTCLM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-acetylpyrazine-2-carboxamide |
| InChIKey | ALPVAENMJMTCLM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=N1)C(=O)N |
Computed by PubChem (NCBI)