CAS 2734774-02-6 is the registry number for 2-Bromo-4'-fluoro-4-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-1-(4-fluorophenyl)-4-methylbenzene (CAS 2734774-02-6) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 2-bromo-1-(4-fluorophenyl)-4-methylbenzene. InChIKey: RYTGRRIOVMDCME-UHFFFAOYSA-N.
| Molecular formula | C13H10BrF |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 2-bromo-1-(4-fluorophenyl)-4-methylbenzene |
| InChIKey | RYTGRRIOVMDCME-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)