Products 884512-78-1

CAS 884512-78-1 is the registry number for 2-Bromo-6-fluoro-3'-methylbiphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-bromo-3-fluoro-2-(3-methylphenyl)benzene (CAS 884512-78-1) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 1-bromo-3-fluoro-2-(3-methylphenyl)benzene. InChIKey: KQZUIFSYZYNHOI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BrF
Molecular weight265.12 g/mol
IUPAC name1-bromo-3-fluoro-2-(3-methylphenyl)benzene
InChIKeyKQZUIFSYZYNHOI-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=C(C=CC=C2Br)F

Computed by PubChem (NCBI)