Products 193013-76-2
CAS 193013-76-2 appears in our catalog under these names: 4'–(Bromomethyl)–2–fluoro–1，1'–biphenyl, 4'-(Bromomethyl)-2-fluoro-1,1'-biphenyl 97%, 4'-(Bromomethyl)-2-fluoro-1,1'-biphenyl, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(bromomethyl)-4-(2-fluorophenyl)benzene (CAS 193013-76-2) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 1-(bromomethyl)-4-(2-fluorophenyl)benzene. InChIKey: SAUALJYDYRRWPW-UHFFFAOYSA-N.
| Molecular formula | C13H10BrF |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(2-fluorophenyl)benzene |
| InChIKey | SAUALJYDYRRWPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CBr)F |
Computed by PubChem (NCBI)