Products 2404733-84-0
CAS 2404733-84-0 appears in our catalog under these names: 2-Bromo-4-fluoro-4'-methyl-1,1'-biphenyl, 95%, 2-Bromo-4-fluoro-4'-methyl-1,1'-biphenyl. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-bromo-4-fluoro-1-(4-methylphenyl)benzene (CAS 2404733-84-0) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(4-methylphenyl)benzene. InChIKey: SHQLNSCWKTXCFL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrF |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(4-methylphenyl)benzene |
| InChIKey | SHQLNSCWKTXCFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)F)Br |
Computed by PubChem (NCBI)