Products 14758-99-7
CAS 14758-99-7 appears in our catalog under these names: alpha-(Dimethylamino)phenylacetic Acid, 2–(Dimethylamino)–2–phenylacetic acid, 2-(Dimethylamino)-2-phenylacetic acid 95%, α-(Dimethylamino)phenylacetic acid, 95%, 95%, 2-(DIMETHYLAMINO)-2-PHENYLACETIC ACID, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 750mg, 100mg, 1g, 250mg, 5g, 10g.
2-(dimethylamino)-2-phenylacetic acid (CAS 14758-99-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-(dimethylamino)-2-phenylacetic acid. InChIKey: MLOBRLOZPSSKKO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-(dimethylamino)-2-phenylacetic acid |
| InChIKey | MLOBRLOZPSSKKO-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(dimethylamino)-2-phenylacetic acid, alpha-(Dimethylamino)phenylacetic Acid, N,N-dimethylphenylglycine, (DIMETHYLAMINO)(PHENYL)ACETIC ACID, Dimethylamino-phenyl-acetic acid, |_-(Dimethylamino)phenylacetic acid, 2-(dimethylamino)-2-phenylaceticacid, alpha-(DiMethylaMino)benzeneacetic Acid, 2-(dimethylamino)-2-phenyl-acetic acid