CAS 29810-09-1 appears in our catalog under these names: (R)-2-(Dimethylamino)-2-phenylacetic acid, 96%, (R)-2-(Dimethylamino)-2-phenylacetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
(2R)-2-(dimethylamino)-2-phenylacetic acid (CAS 29810-09-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-(dimethylamino)-2-phenylacetic acid. InChIKey: MLOBRLOZPSSKKO-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-(dimethylamino)-2-phenylacetic acid |
| InChIKey | MLOBRLOZPSSKKO-SECBINFHSA-N |
| SMILES | CN(C)[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)