Products 1476027-18-5
CAS 1476027-18-5 is the registry number for 1-[3-Methyl-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]ethanone (CAS 1476027-18-5) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]ethanone. InChIKey: ZTFOLQQDGOQEMC-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]ethanone |
| InChIKey | ZTFOLQQDGOQEMC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C)OCC(F)(F)F |
Computed by PubChem (NCBI)