CAS 147648-81-5 is the registry number for α-L-Glucose pentaacetate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,3S,4R,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 147648-81-5) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2S,3S,4R,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-ARKGTOAJSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2S,3S,4R,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-ARKGTOAJSA-N |
| SMILES | CC(=O)OC[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)