Products 1477817-59-6
CAS 1477817-59-6 is the registry number for 3-{2,4-Dioxo-1,3-diazaspiro(4.4)nonan-3-yl}-2-hydroxy-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-2-hydroxy-2-methylpropanoic acid (CAS 1477817-59-6) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-2-hydroxy-2-methylpropanoic acid. InChIKey: KHACJPBCVMCFSV-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-2-hydroxy-2-methylpropanoic acid |
| InChIKey | KHACJPBCVMCFSV-UHFFFAOYSA-N |
| SMILES | CC(CN1C(=O)C2(CCCC2)NC1=O)(C(=O)O)O |
Computed by PubChem (NCBI)