Products 14788-14-8

CAS 14788-14-8 appears in our catalog under these names: 3-(Pyrrolidin-1-yl)propanoic acid hydrochloride, 96%, 3-Pyrrolidin-1-yl-propionic acid HCl, 3-(Pyrrolidin-1-yl)propanoic acid hydrochloride, 95%, 95%, 3-Pyrrolidin-1-yl-propionic acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-pyrrolidin-1-ylpropanoic acid;hydrochloride (CAS 14788-14-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 3-pyrrolidin-1-ylpropanoic acid;hydrochloride. InChIKey: HFYVCFSDZYRPRW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name3-pyrrolidin-1-ylpropanoic acid;hydrochloride
InChIKeyHFYVCFSDZYRPRW-UHFFFAOYSA-N
SMILESC1CCN(C1)CCC(=O)O.Cl

Computed by PubChem (NCBI)