Products 147906-08-9

CAS 147906-08-9 appears in our catalog under these names: (E)-3-(3-Fluoro-4-methoxyphenyl)acrylic acid, 98%, (2E)-3-(3-Fluoro-4-methoxyphenyl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid (CAS 147906-08-9) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: VKZYEBQHWQTZKA-HWKANZROSA-N.

Identity
Molecular formulaC10H9FO3
Molecular weight196.17 g/mol
IUPAC name(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid
InChIKeyVKZYEBQHWQTZKA-HWKANZROSA-N
SMILESCOC1=C(C=C(C=C1)/C=C/C(=O)O)F

Computed by PubChem (NCBI)