CAS 1480388-66-6 appears in our catalog under these names: 5-(3-Chlorophenyl)-1,2-oxazol-3-amine, 95%, 5-(3-Chlorophenyl)-1,2-oxazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(3-chlorophenyl)-1,2-oxazol-3-amine (CAS 1480388-66-6) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,2-oxazol-3-amine. InChIKey: OOFVSXBAFUJIPE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,2-oxazol-3-amine |
| InChIKey | OOFVSXBAFUJIPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=NO2)N |
Computed by PubChem (NCBI)