Products 1482212-27-0
CAS 1482212-27-0 is the registry number for 3-Chloro-5-phenylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-5-phenylbenzenesulfonyl chloride (CAS 1482212-27-0) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 3-chloro-5-phenylbenzenesulfonyl chloride. InChIKey: WETYFAXIBAGMKJ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 3-chloro-5-phenylbenzenesulfonyl chloride |
| InChIKey | WETYFAXIBAGMKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)