CAS 148357-04-4 appears in our catalog under these names: Benzyl 1H-indole-3-carboxylate, 98%, benzyl 1H-indole-3-carboxylate, 98%, 98%, Phenylmethyl 1H-indole-3-carboxylate, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Benzyl 1H-indole-3-carboxylate (CAS 148357-04-4) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: benzyl 1H-indole-3-carboxylate. InChIKey: SEQPSPZFEZDRLX-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | benzyl 1H-indole-3-carboxylate |
| InChIKey | SEQPSPZFEZDRLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)