CAS 1483579-63-0 appears in our catalog under these names: 2,4,6-Trifluoro-N,N-dimethylbenzamide, 95%, 2,4,6-Trifluoro-N,N-dimethylbenzamide, 2,4,6-Trifluoro-N,N-dimethylbenzamide, ≥95%, ≥95%, 2,4,6-Trifluoro-N,N-dimethylbenzamide, ≥95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 1g.
2,4,6-trifluoro-N,N-dimethylbenzamide (CAS 1483579-63-0) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 2,4,6-trifluoro-N,N-dimethylbenzamide. InChIKey: NRDPJANKHFYHRV-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 2,4,6-trifluoro-N,N-dimethylbenzamide |
| InChIKey | NRDPJANKHFYHRV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1F)F)F |
Computed by PubChem (NCBI)