CAS 148401-42-7 is the registry number for 2-(4-(4-Chlorophenoxy)phenyl)acetic Acid. Offered by: TRC. Available pack sizes: 2,5g.
2-[4-(4-chlorophenoxy)phenyl]acetic acid (CAS 148401-42-7) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[4-(4-chlorophenoxy)phenyl]acetic acid. InChIKey: XYWCXPKPSPHSAA-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[4-(4-chlorophenoxy)phenyl]acetic acid |
| InChIKey | XYWCXPKPSPHSAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)