CAS 148517-82-2 appears in our catalog under these names: Donepezil Impurity 10, 3-Hydroxy-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
3-hydroxy-5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 148517-82-2) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-hydroxy-5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: HJPUXZKJTVQHCD-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-hydroxy-5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | HJPUXZKJTVQHCD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=O)CC(C2=C1)O)OC |
Computed by PubChem (NCBI)