CAS 1486-50-6 appears in our catalog under these names: 4-(Benzyloxy)benzoyl chloride, 95%, 4-(Benzyloxy)benzoyl chloride 98%, 4-BENZYLOXYBENZOYLCHLORIDE, 95%, 4-(benzyloxy)benzoyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 25g.
4-phenylmethoxybenzoyl chloride (CAS 1486-50-6) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 4-phenylmethoxybenzoyl chloride. InChIKey: ICEKEZSKMGHZNT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-phenylmethoxybenzoyl chloride |
| InChIKey | ICEKEZSKMGHZNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)