Products 14866-28-5
CAS 14866-28-5 appears in our catalog under these names: Isoconazole Impurity 7, Isoconazole Impurity 15, 1-(2,4-dichlorophenyl)ethane-1,2-diol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-(2,4-dichlorophenyl)ethane-1,2-diol (CAS 14866-28-5) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)ethane-1,2-diol. InChIKey: HZAZETJSOZQUJL-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)ethane-1,2-diol |
| InChIKey | HZAZETJSOZQUJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CO)O |
Computed by PubChem (NCBI)
Synonyms:
1-(2,4-Dichlorophenyl)ethane-1,2-diol, Cyanocobalamin-d-carboxylic acid, 1-(2,4-dichlorophenyl)-1,2-ethanediol, Econazole Impurity 8, 1,2-Ethanediol,1-(2,4-dichlorophenyl)-, (2,4-Dichlorophenyl)ethane-1,2-diol, (s)-1-(2,4-dichlorophenyl)-1,2-ethanediol, (2,4-Dichlorophenyl)ethane-1,2-diol; 2,4-Dichlorophenylethanediol