Products 77611-68-8

CAS 77611-68-8 is the registry number for 2-(3-Nitropropyl)-2,3-dihydro-1h-isoindole-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3-nitropropyl)isoindole-1,3-dione (CAS 77611-68-8) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 2-(3-nitropropyl)isoindole-1,3-dione. InChIKey: CRXXTBGPVDVHPD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O4
Molecular weight234.21 g/mol
IUPAC name2-(3-nitropropyl)isoindole-1,3-dione
InChIKeyCRXXTBGPVDVHPD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCC[N+](=O)[O-]

Computed by PubChem (NCBI)