CAS 148819-80-1 appears in our catalog under these names: Naphthalen-2-amine hydrobromide, 95+%, 2-Naphthylammoniumbromide-98%,,, ≥98%, ≥98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g.
Naphthalen-2-amine;hydrobromide (CAS 148819-80-1) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: naphthalen-2-amine;hydrobromide. InChIKey: RIWJTTOJHYQBRN-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | naphthalen-2-amine;hydrobromide |
| InChIKey | RIWJTTOJHYQBRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)N.Br |
Computed by PubChem (NCBI)