CAS 148857-42-5 appears in our catalog under these names: Rivaroxaban Impurity 63, 2-((2S)-3-Chloro-2-hydroxypropyl)-1H-isoindole-1,3(2H)-dione, >95% (HPLC), 2-((2S)-3-Chloro-2-hydroxypropyl)-1H-isoindole-1,3(2H)-dione, (S)-2-(3-Chloro-2-hydroxypropyl)isoindoline-1,3-dione 95%, (S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Fluorochem. Available pack sizes: on request, 10g, 1g, 100mg, 250mg, 5g, 25g.
2-[(2S)-3-chloro-2-hydroxypropyl]isoindole-1,3-dione (CAS 148857-42-5) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 2-[(2S)-3-chloro-2-hydroxypropyl]isoindole-1,3-dione. InChIKey: KBRVYEPWGIQEOF-SSDOTTSWSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 2-[(2S)-3-chloro-2-hydroxypropyl]isoindole-1,3-dione |
| InChIKey | KBRVYEPWGIQEOF-SSDOTTSWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C[C@@H](CCl)O |
Computed by PubChem (NCBI)