CAS 1490297-97-6 is the registry number for 2-(1-Methyl-1H-pyrazol-3-yl)thiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxylic acid (CAS 1490297-97-6) is a chemical compound with the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. IUPAC name: 2-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: HWAPCWABOPYFKE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | 2-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | HWAPCWABOPYFKE-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)