CAS 2763157-33-9 is the registry number for 2-(Methylthio)pyrido[4,3-d]pyrimidine-5,7(6H,8H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfanyl-8H-pyrido[4,3-d]pyrimidine-5,7-dione (CAS 2763157-33-9) is a chemical compound with the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. IUPAC name: 2-methylsulfanyl-8H-pyrido[4,3-d]pyrimidine-5,7-dione. InChIKey: SGZOBABGSJIEPR-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | 2-methylsulfanyl-8H-pyrido[4,3-d]pyrimidine-5,7-dione |
| InChIKey | SGZOBABGSJIEPR-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)CC(=O)NC2=O |
Computed by PubChem (NCBI)