Products 848369-73-3
CAS 848369-73-3 is the registry number for N'-(2-Cyanoacetyl)thiophene-2-carbohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N'-(2-cyanoacetyl)thiophene-2-carbohydrazide (CAS 848369-73-3) is a chemical compound with the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. IUPAC name: N'-(2-cyanoacetyl)thiophene-2-carbohydrazide. InChIKey: GUVUHIVKEXDRDX-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | N'-(2-cyanoacetyl)thiophene-2-carbohydrazide |
| InChIKey | GUVUHIVKEXDRDX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NNC(=O)CC#N |
Computed by PubChem (NCBI)