CAS 294653-40-0 is the registry number for N-(5-Methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (CAS 294653-40-0) is a chemical compound with the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. IUPAC name: N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide. InChIKey: ZAVXDLFAONKFFV-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| InChIKey | ZAVXDLFAONKFFV-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)