CAS 2105156-06-5 is the registry number for Methyl 2-(1H-imidazol-4-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylate (CAS 2105156-06-5) is a chemical compound with the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. IUPAC name: methyl 2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylate. InChIKey: JUCPYCRPELCEMZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | methyl 2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | JUCPYCRPELCEMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CN=CN2 |
Computed by PubChem (NCBI)