Products 149030-02-4
CAS 149030-02-4 is the registry number for p-Hydroxyphenylethyl p-coumarate. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (CAS 149030-02-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxyphenyl)prop-2-enoate. InChIKey: ZCFLGZLKECDZFW-BJMVGYQFSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChIKey | ZCFLGZLKECDZFW-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1CCOC(=O)/C=C/C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)