Products 149288-38-0
CAS 149288-38-0 is the registry number for 4-(2-Chlorophenoxymethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 10g.
4-[(2-chlorophenoxy)methyl]benzoic acid (CAS 149288-38-0) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 4-[(2-chlorophenoxy)methyl]benzoic acid. InChIKey: YJDZJDKPESDFTK-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 4-[(2-chlorophenoxy)methyl]benzoic acid |
| InChIKey | YJDZJDKPESDFTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)