Products 149288-47-1
CAS 149288-47-1 appears in our catalog under these names: 4-((2,4-Dichlorophenoxy)methyl)benzoic acid, 95+%, 4-((2,4-Dichlorophenoxy)methyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
4-[(2,4-dichlorophenoxy)methyl]benzoic acid (CAS 149288-47-1) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 4-[(2,4-dichlorophenoxy)methyl]benzoic acid. InChIKey: SFELUKIAJDZQSF-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 4-[(2,4-dichlorophenoxy)methyl]benzoic acid |
| InChIKey | SFELUKIAJDZQSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)