Products 1493697-32-7
CAS 1493697-32-7 is the registry number for 5-Methyl-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methyl-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione (CAS 1493697-32-7) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 5-methyl-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione. InChIKey: GFMRGUGYHJTZRI-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 5-methyl-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| InChIKey | GFMRGUGYHJTZRI-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=NC=CS2 |
Computed by PubChem (NCBI)