CAS 149382-38-7 is the registry number for Dimethyl cubane-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl cubane-1,3-dicarboxylate (CAS 149382-38-7) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: dimethyl cubane-1,3-dicarboxylate. InChIKey: AXYYDLQMEZRXDK-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | dimethyl cubane-1,3-dicarboxylate |
| InChIKey | AXYYDLQMEZRXDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5(C4C3C25)C(=O)OC |
Computed by PubChem (NCBI)