Products 1495766-04-5

CAS 1495766-04-5 is the registry number for 4-(1-Phenyl-1H-1,2,3-triazol-4-yl)benzoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

4-(1-phenyltriazol-4-yl)benzoic acid (CAS 1495766-04-5) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: 4-(1-phenyltriazol-4-yl)benzoic acid. InChIKey: ADEPDQVDKWMAJP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11N3O2
Molecular weight265.27 g/mol
IUPAC name4-(1-phenyltriazol-4-yl)benzoic acid
InChIKeyADEPDQVDKWMAJP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C=C(N=N2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)