CAS 24058-92-2 is the registry number for Diphenyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,5-diphenyl-1,2,4-triazole-3-carboxylic acid (CAS 24058-92-2) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: 1,5-diphenyl-1,2,4-triazole-3-carboxylic acid. InChIKey: RBJKFWPNGGRTOV-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O2 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | 1,5-diphenyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | RBJKFWPNGGRTOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)