Products 24058-92-2

CAS 24058-92-2 is the registry number for Diphenyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1,5-diphenyl-1,2,4-triazole-3-carboxylic acid (CAS 24058-92-2) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: 1,5-diphenyl-1,2,4-triazole-3-carboxylic acid. InChIKey: RBJKFWPNGGRTOV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11N3O2
Molecular weight265.27 g/mol
IUPAC name1,5-diphenyl-1,2,4-triazole-3-carboxylic acid
InChIKeyRBJKFWPNGGRTOV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=NN2C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)